C13H14ClN3O2 — CID 89447707
5-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylidene-1,3-diazinane-4,6-dione (PubChem CID 89447707) has the molecular formula C13H14ClN3O2 and a molecular weight of 279.73 g/mol. Its IUPAC name is 5-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 89447707 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 5-[(6-chloro-3-pyridinyl)methyl]-5-ethyl-2-methylidene-1,3-diazinane-4,6-dione |
| SMILES | C=C1NC(=O)C(CC)(Cc2ccc(Cl)nc2)C(=O)N1 |
| InChI | InChI=1S/C13H14ClN3O2/c1-3-13(6-9-4-5-10(14)15-7-9)11(18)16-8(2)17-12(13)19/h4-5,7H,2-3,6H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | XXPMQTFZMQVXLC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|