C12H12FN3O3 — CID 71536911
5-ethyl-5-[(6-(18F)fluoro-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 71536911) has the molecular formula C12H12FN3O3 and a molecular weight of 264.25 g/mol. Its IUPAC name is 5-ethyl-5-[(6-(18F)fluoro-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-5-[(6-(18F)fluoro-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71536911 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 5-ethyl-5-[(6-(18F)fluoro-3-pyridinyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(Cc2ccc([18F])nc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C12H12FN3O3/c1-2-12(5-7-3-4-8(13)14-6-7)9(17)15-11(19)16-10(12)18/h3-4,6H,2,5H2,1H3,(H2,15,16,17,18,19)/i13-1 |
| InChIKey | QBPJWKQANFRGKJ-HSGWXFLFSA-N |
| XLogP | 0.53 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|