C14H16F3NO3 — CID 120515987
2-methyl-2-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]propanoic acid (PubChem CID 120515987) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-methyl-2-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 120515987 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-methyl-2-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]propanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc(CCC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C14H16F3NO3/c1-13(2,12(20)21)18-11(19)10-5-3-9(4-6-10)7-8-14(15,16)17/h3-6H,7-8H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | BHYGNGLLMGCQRS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |