C13H14F3NO4 — CID 119187579
2-methyl-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]propanoic acid (PubChem CID 119187579) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-methyl-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119187579 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-methyl-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]propanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc(OCC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C13H14F3NO4/c1-12(2,11(19)20)17-10(18)8-3-5-9(6-4-8)21-7-13(14,15)16/h3-6H,7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | XGWOUTICWHKHIZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |