C19H20F3NO2 — CID 55607000
N-(2-phenylbutyl)-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 55607000) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-(2-phenylbutyl)-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2-phenylbutyl)-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 55607000 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(2-phenylbutyl)-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CCC(CNC(=O)c1ccc(OCC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H20F3NO2/c1-2-14(15-6-4-3-5-7-15)12-23-18(24)16-8-10-17(11-9-16)25-13-19(20,21)22/h3-11,14H,2,12-13H2,1H3,(H,23,24) |
| InChIKey | ALMGCCYOOSCHSG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |