C14H16F3NO5 — CID 120702424
4-methoxy-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]butanoic acid (PubChem CID 120702424) has the molecular formula C14H16F3NO5 and a molecular weight of 335.28 g/mol. Its IUPAC name is 4-methoxy-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]butanoic acid.
| Compound Name | 4-methoxy-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120702424 |
| Molecular Formula | C14H16F3NO5 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-methoxy-2-[[4-(2,2,2-trifluoroethoxy)benzoyl]amino]butanoic acid |
| SMILES | COCCC(NC(=O)c1ccc(OCC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C14H16F3NO5/c1-22-7-6-11(13(20)21)18-12(19)9-2-4-10(5-3-9)23-8-14(15,16)17/h2-5,11H,6-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | ZSQNFMUCPDHBDE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |