C16H25NOS — CID 158735809
(R)-N-[4-(3,4-dimethylphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide (PubChem CID 158735809) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is (R)-N-[4-(3,4-dimethylphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[4-(3,4-dimethylphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 158735809 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (R)-N-[4-(3,4-dimethylphenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(CCc1ccc(C)c(C)c1)=N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C16H25NOS/c1-12-7-9-15(11-13(12)2)10-8-14(3)17-19(18)16(4,5)6/h7,9,11H,8,10H2,1-6H3/t19-/m1/s1 |
| InChIKey | JILWFGYDPWSSJO-LJQANCHMSA-N |
| XLogP | 4.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|