C19H22O — CID 24726455
3-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)propan-1-one (PubChem CID 24726455) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)propan-1-one.
| Compound Name | 3-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 24726455 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-(3,5-dimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)cc(C(=O)CCc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C19H22O/c1-13-9-14(2)11-18(10-13)19(20)8-7-17-6-5-15(3)16(4)12-17/h5-6,9-12H,7-8H2,1-4H3 |
| InChIKey | AXWVCMCYTDTOBX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |