C17H17ClO — CID 24726042
3-(3-chlorophenyl)-1-(3,5-dimethylphenyl)propan-1-one (PubChem CID 24726042) has the molecular formula C17H17ClO and a molecular weight of 272.77 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(3,5-dimethylphenyl)propan-1-one.
| Compound Name | 3-(3-chlorophenyl)-1-(3,5-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 24726042 |
| Molecular Formula | C17H17ClO |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(3,5-dimethylphenyl)propan-1-one |
| SMILES | Cc1cc(C)cc(C(=O)CCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H17ClO/c1-12-8-13(2)10-15(9-12)17(19)7-6-14-4-3-5-16(18)11-14/h3-5,8-11H,6-7H2,1-2H3 |
| InChIKey | LPBICGCKERRRMC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |