C19H21F3OS — CID 142845999
ethene;1-(4-methylsulfinylphenyl)-4-(4,4,4-trifluorobutyl)benzene (PubChem CID 142845999) has the molecular formula C19H21F3OS and a molecular weight of 354.44 g/mol. Its IUPAC name is ethene;1-(4-methylsulfinylphenyl)-4-(4,4,4-trifluorobutyl)benzene.
| Compound Name | ethene;1-(4-methylsulfinylphenyl)-4-(4,4,4-trifluorobutyl)benzene |
|---|---|
| PubChem CID | 142845999 |
| Molecular Formula | C19H21F3OS |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | ethene;1-(4-methylsulfinylphenyl)-4-(4,4,4-trifluorobutyl)benzene |
| SMILES | C=C.CS(=O)c1ccc(-c2ccc(CCCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H17F3OS.C2H4/c1-22(21)16-10-8-15(9-11-16)14-6-4-13(5-7-14)3-2-12-17(18,19)20;1-2/h4-11H,2-3,12H2,1H3;1-2H2 |
| InChIKey | RLBCCNPGAXFYBT-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|