C16H17F3 — CID 123278039
1-hexa-1,3,5-trien-3-yl-4-(4,4,4-trifluorobutyl)benzene (PubChem CID 123278039) has the molecular formula C16H17F3 and a molecular weight of 266.31 g/mol. Its IUPAC name is 1-hexa-1,3,5-trien-3-yl-4-(4,4,4-trifluorobutyl)benzene.
| Compound Name | 1-hexa-1,3,5-trien-3-yl-4-(4,4,4-trifluorobutyl)benzene |
|---|---|
| PubChem CID | 123278039 |
| Molecular Formula | C16H17F3 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-hexa-1,3,5-trien-3-yl-4-(4,4,4-trifluorobutyl)benzene |
| SMILES | C=CC=C(C=C)c1ccc(CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3/c1-3-6-14(4-2)15-10-8-13(9-11-15)7-5-12-16(17,18)19/h3-4,6,8-11H,1-2,5,7,12H2 |
| InChIKey | GKMPYHWBFNQKNX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|