C25H38N2O2 — CID 142832286
ethane;2-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]ethyl]-3,6-dimethoxy-2,5-dihydropyrazine;propane (PubChem CID 142832286) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is ethane;2-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]ethyl]-3,6-dimethoxy-2,5-dihydropyrazine;propane.
| Compound Name | ethane;2-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]ethyl]-3,6-dimethoxy-2,5-dihydropyrazine;propane |
|---|---|
| PubChem CID | 142832286 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | ethane;2-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]ethyl]-3,6-dimethoxy-2,5-dihydropyrazine;propane |
| SMILES | C=C/C=C(\C=C)c1ccc(CCC2N=C(OC)CN=C2OC)cc1.CC.CCC |
| InChI | InChI=1S/C20H24N2O2.C3H8.C2H6/c1-5-7-16(6-2)17-11-8-15(9-12-17)10-13-18-20(24-4)21-14-19(22-18)23-3;1-3-2;1-2/h5-9,11-12,18H,1-2,10,13-14H2,3-4H3;3H2,1-2H3;1-2H3/b16-7+;; |
| InChIKey | COVCMWNFJQEURA-WHYKZYOGSA-N |
| XLogP | 6.29 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|