C26H33F3N2O4S — CID 10075568
1-tert-butyl-N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 10075568) has the molecular formula C26H33F3N2O4S and a molecular weight of 526.62 g/mol. Its IUPAC name is 1-tert-butyl-N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-tert-butyl-N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10075568 |
| Molecular Formula | C26H33F3N2O4S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 1-tert-butyl-N-hydroxy-4-[4-[4-(4,4,4-trifluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)N1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C26H33F3N2O4S/c1-24(2,3)31-17-15-25(16-18-31,23(32)30-33)36(34,35)22-12-10-21(11-13-22)20-8-6-19(7-9-20)5-4-14-26(27,28)29/h6-13,33H,4-5,14-18H2,1-3H3,(H,30,32) |
| InChIKey | FWZVXBCJTAMIJR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|