C23H30Cl2F2N4O4S — CID 162334793
1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride (PubChem CID 162334793) has the molecular formula C23H30Cl2F2N4O4S and a molecular weight of 567.49 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride.
| Compound Name | 1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162334793 |
| Molecular Formula | C23H30Cl2F2N4O4S |
| Molecular Weight | 567.49 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 1-cyclopropyl-4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride |
| SMILES | CC(F)(F)CCc1cnc(-c2ccc(S(=O)(=O)C3(C(=O)NO)CCN(C4CC4)CC3)cc2)cn1.Cl.Cl |
| InChI | InChI=1S/C23H28F2N4O4S.2ClH/c1-22(24,25)9-8-17-14-27-20(15-26-17)16-2-6-19(7-3-16)34(32,33)23(21(30)28-31)10-12-29(13-11-23)18-4-5-18;;/h2-3,6-7,14-15,18,31H,4-5,8-13H2,1H3,(H,28,30);2*1H |
| InChIKey | QNDXPKDLCIQVEK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|