C22H26ClN3O5S — CID 159072100
N-hydroxy-4-[4-[5-(4-methylpent-1-ynyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 159072100) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(4-methylpent-1-ynyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[5-(4-methylpent-1-ynyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 159072100 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-hydroxy-4-[4-[5-(4-methylpent-1-ynyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | CC(C)CC#Cc1cnc(-c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cc2)cn1.Cl |
| InChI | InChI=1S/C22H25N3O5S.ClH/c1-16(2)4-3-5-18-14-24-20(15-23-18)17-6-8-19(9-7-17)31(28,29)22(21(26)25-27)10-12-30-13-11-22;/h6-9,14-16,27H,4,10-13H2,1-2H3,(H,25,26);1H |
| InChIKey | DMBUIZKZCCKRRJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|