C26H25ClF3N3O7S — CID 158934019
N-hydroxy-4-[[6-[4-[methyl-[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-3-pyridinyl]sulfonyl]oxane-4-carboxamide;hydrochloride (PubChem CID 158934019) has the molecular formula C26H25ClF3N3O7S and a molecular weight of 616.01 g/mol. Its IUPAC name is N-hydroxy-4-[[6-[4-[methyl-[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-3-pyridinyl]sulfonyl]oxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[[6-[4-[methyl-[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-3-pyridinyl]sulfonyl]oxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 158934019 |
| Molecular Formula | C26H25ClF3N3O7S |
| Molecular Weight | 616.01 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | N-hydroxy-4-[[6-[4-[methyl-[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl]-3-pyridinyl]sulfonyl]oxane-4-carboxamide;hydrochloride |
| SMILES | CN(C(=O)c1ccc(-c2ccc(S(=O)(=O)C3(C(=O)NO)CCOCC3)cn2)cc1)c1ccc(OC(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C26H24F3N3O7S.ClH/c1-32(19-6-8-20(9-7-19)39-26(27,28)29)23(33)18-4-2-17(3-5-18)22-11-10-21(16-30-22)40(36,37)25(24(34)31-35)12-14-38-15-13-25;/h2-11,16,35H,12-15H2,1H3,(H,31,34);1H |
| InChIKey | ODRVKSJCNORJAV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.01 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|