C22H30Cl2F2N4O4S — CID 169425851
4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-ethyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride (PubChem CID 169425851) has the molecular formula C22H30Cl2F2N4O4S and a molecular weight of 555.48 g/mol. Its IUPAC name is 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-ethyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride.
| Compound Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-ethyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 169425851 |
| Molecular Formula | C22H30Cl2F2N4O4S |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-ethyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride |
| SMILES | CCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3cnc(CCC(C)(F)F)cn3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H28F2N4O4S.2ClH/c1-3-28-12-10-22(11-13-28,20(29)27-30)33(31,32)18-6-4-16(5-7-18)19-15-25-17(14-26-19)8-9-21(2,23)24;;/h4-7,14-15,30H,3,8-13H2,1-2H3,(H,27,29);2*1H |
| InChIKey | FCTHITJNKYBWKC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|