C24H28ClF5N2O4S — CID 158345546
1-ethyl-N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 158345546) has the molecular formula C24H28ClF5N2O4S and a molecular weight of 571.01 g/mol. Its IUPAC name is 1-ethyl-N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-ethyl-N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 158345546 |
| Molecular Formula | C24H28ClF5N2O4S |
| Molecular Weight | 571.01 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 1-ethyl-N-hydroxy-4-[4-[4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3)cc2)CC1.Cl |
| InChI | InChI=1S/C24H27F5N2O4S.ClH/c1-2-31-15-13-22(14-16-31,21(32)30-33)36(34,35)20-9-7-19(8-10-20)18-5-3-17(4-6-18)11-12-23(25,26)24(27,28)29;/h3-10,33H,2,11-16H2,1H3,(H,30,32);1H |
| InChIKey | QRERZPNEIZEVNG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.01 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|