About dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene
dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene (PubChem CID 134900367) has the molecular formula C10H14Cl2OPtS
and a molecular weight of 448.27 g/mol. Its IUPAC name is dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene.
Molecular Properties
| Compound Name | dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene |
| PubChem CID | 134900367 |
| Molecular Formula | C10H14Cl2OPtS |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene |
| SMILES | C=C.Cc1ccc(S(C)=O)cc1.Cl[Pt]Cl |
| InChI | InChI=1S/C8H10OS.C2H4.2ClH.Pt/c1-7-3-5-8(6-4-7)10(2)9;1-2;;;/h3-6H,1-2H3;1-2H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | CBSLYWYCWRJGFT-UHFFFAOYSA-L |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene?
The IUPAC name of dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene (CID 134900367) is dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene.
What is the SMILES notation for dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene?
The canonical SMILES for dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene is C=C.Cc1ccc(S(C)=O)cc1.Cl[Pt]Cl.
What is the InChIKey of dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene?
The InChIKey is CBSLYWYCWRJGFT-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10OS.C2H4.2ClH.Pt/c1-7-3-5-8(6-4-7)10(2)9;1-2;;;/h3-6H,1-2H3;1-2H2;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene?
dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene has a molecular weight of 448.27 g/mol, XLogP of 3.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;ethene;1-methyl-4-methylsulfinylbenzene is sourced from PubChem (CID 134900367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).