About chloromercury(1+);4-methylbenzenesulfinate
chloromercury(1+);4-methylbenzenesulfinate (PubChem CID 134889927) has the molecular formula C7H7ClHgO2S
and a molecular weight of 391.24 g/mol. Its IUPAC name is chloromercury(1+);4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | chloromercury(1+);4-methylbenzenesulfinate |
| PubChem CID | 134889927 |
| Molecular Formula | C7H7ClHgO2S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | chloromercury(1+);4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)[O-])cc1.Cl[Hg+] |
| InChI | InChI=1S/C7H8O2S.ClH.Hg/c1-6-2-4-7(5-3-6)10(8)9;;/h2-5H,1H3,(H,8,9);1H;/q;;+2/p-2 |
| InChIKey | DZUOTIGBWCRKDD-UHFFFAOYSA-L |
| XLogP | 1.92 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze chloromercury(1+);4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromercury(1+);4-methylbenzenesulfinate?
The IUPAC name of chloromercury(1+);4-methylbenzenesulfinate (CID 134889927) is chloromercury(1+);4-methylbenzenesulfinate.
What is the SMILES notation for chloromercury(1+);4-methylbenzenesulfinate?
The canonical SMILES for chloromercury(1+);4-methylbenzenesulfinate is Cc1ccc(S(=O)[O-])cc1.Cl[Hg+].
What is the InChIKey of chloromercury(1+);4-methylbenzenesulfinate?
The InChIKey is DZUOTIGBWCRKDD-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H8O2S.ClH.Hg/c1-6-2-4-7(5-3-6)10(8)9;;/h2-5H,1H3,(H,8,9);1H;/q;;+2/p-2.
What are the key properties of chloromercury(1+);4-methylbenzenesulfinate?
chloromercury(1+);4-methylbenzenesulfinate has a molecular weight of 391.24 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromercury(1+);4-methylbenzenesulfinate is sourced from PubChem (CID 134889927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).