About sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane
sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane (PubChem CID 67929941) has the molecular formula C7H7NaOS2
and a molecular weight of 194.26 g/mol. Its IUPAC name is sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane.
Molecular Properties
| Compound Name | sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane |
| PubChem CID | 67929941 |
| Molecular Formula | C7H7NaOS2 |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane |
| SMILES | Cc1ccc(S([O-])=S)cc1.[Na+] |
| InChI | InChI=1S/C7H8OS2.Na/c1-6-2-4-7(5-3-6)10(8)9;/h2-5H,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | LTJLJRITXLSZQH-UHFFFAOYSA-M |
| XLogP | -1.43 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane?
The IUPAC name of sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane (CID 67929941) is sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane.
What is the SMILES notation for sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane?
The canonical SMILES for sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane is Cc1ccc(S([O-])=S)cc1.[Na+].
What is the InChIKey of sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane?
The InChIKey is LTJLJRITXLSZQH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8OS2.Na/c1-6-2-4-7(5-3-6)10(8)9;/h2-5H,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane?
sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane has a molecular weight of 194.26 g/mol, XLogP of -1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (4-methylphenyl)-oxido-sulfanylidene-λ4-sulfane is sourced from PubChem (CID 67929941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).