C15H11F2NOSe — CID 11667228
4-(2,2-difluoro-1-hydroxy-2-phenylselanylethyl)benzonitrile (PubChem CID 11667228) has the molecular formula C15H11F2NOSe and a molecular weight of 338.22 g/mol. Its IUPAC name is 4-(2,2-difluoro-1-hydroxy-2-phenylselanylethyl)benzonitrile.
| Compound Name | 4-(2,2-difluoro-1-hydroxy-2-phenylselanylethyl)benzonitrile |
|---|---|
| PubChem CID | 11667228 |
| Molecular Formula | C15H11F2NOSe |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 4-(2,2-difluoro-1-hydroxy-2-phenylselanylethyl)benzonitrile |
| SMILES | N#Cc1ccc(C(O)C(F)(F)[Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11F2NOSe/c16-15(17,20-13-4-2-1-3-5-13)14(19)12-8-6-11(10-18)7-9-12/h1-9,14,19H |
| InChIKey | CVNMDIGAGIVERX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|