C26H22OSe3 — CID 12736557
1-phenyl-2,2,2-tris(phenylselanyl)ethanol (PubChem CID 12736557) has the molecular formula C26H22OSe3 and a molecular weight of 587.34 g/mol. Its IUPAC name is 1-phenyl-2,2,2-tris(phenylselanyl)ethanol.
| Compound Name | 1-phenyl-2,2,2-tris(phenylselanyl)ethanol |
|---|---|
| PubChem CID | 12736557 |
| Molecular Formula | C26H22OSe3 |
| Molecular Weight | 587.34 g/mol |
| Exact Mass | 589.92 |
| IUPAC Name | 1-phenyl-2,2,2-tris(phenylselanyl)ethanol |
| SMILES | OC(c1ccccc1)C([Se]c1ccccc1)([Se]c1ccccc1)[Se]c1ccccc1 |
| InChI | InChI=1S/C26H22OSe3/c27-25(21-13-5-1-6-14-21)26(28-22-15-7-2-8-16-22,29-23-17-9-3-10-18-23)30-24-19-11-4-12-20-24/h1-20,25,27H |
| InChIKey | UTZPOUFUIXCBMT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|