C17H15NO4 — CID 141252703
methyl 3-(4-cyanophenyl)-2,3-dihydroxy-2-phenylpropanoate (PubChem CID 141252703) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 3-(4-cyanophenyl)-2,3-dihydroxy-2-phenylpropanoate.
| Compound Name | methyl 3-(4-cyanophenyl)-2,3-dihydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 141252703 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | methyl 3-(4-cyanophenyl)-2,3-dihydroxy-2-phenylpropanoate |
| SMILES | COC(=O)C(O)(c1ccccc1)C(O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H15NO4/c1-22-16(20)17(21,14-5-3-2-4-6-14)15(19)13-9-7-12(11-18)8-10-13/h2-10,15,19,21H,1H3 |
| InChIKey | PKJVHCOEFXZPGZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |