C16H14N2O8 — CID 141252706
methyl 3-(2,4-dinitrophenyl)-2,3-dihydroxy-2-phenylpropanoate (PubChem CID 141252706) has the molecular formula C16H14N2O8 and a molecular weight of 362.29 g/mol. Its IUPAC name is methyl 3-(2,4-dinitrophenyl)-2,3-dihydroxy-2-phenylpropanoate.
| Compound Name | methyl 3-(2,4-dinitrophenyl)-2,3-dihydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 141252706 |
| Molecular Formula | C16H14N2O8 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | methyl 3-(2,4-dinitrophenyl)-2,3-dihydroxy-2-phenylpropanoate |
| SMILES | COC(=O)C(O)(c1ccccc1)C(O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N2O8/c1-26-15(20)16(21,10-5-3-2-4-6-10)14(19)12-8-7-11(17(22)23)9-13(12)18(24)25/h2-9,14,19,21H,1H3 |
| InChIKey | IYXFGEZCSKDYGL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 153.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|