C27H21NO4 — CID 158531018
(2-methyl-4-nitrophenyl) 2,2,2-triphenylacetate (PubChem CID 158531018) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is (2-methyl-4-nitrophenyl) 2,2,2-triphenylacetate.
| Compound Name | (2-methyl-4-nitrophenyl) 2,2,2-triphenylacetate |
|---|---|
| PubChem CID | 158531018 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (2-methyl-4-nitrophenyl) 2,2,2-triphenylacetate |
| SMILES | Cc1cc([N+](=O)[O-])ccc1OC(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21NO4/c1-20-19-24(28(30)31)17-18-25(20)32-26(29)27(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-19H,1H3 |
| InChIKey | GKZMSMBSDAAINB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|