C13H16N2O2 — CID 171245582
methyl (3S)-3-amino-3-(4-cyanophenyl)-2,2-dimethylpropanoate (PubChem CID 171245582) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(4-cyanophenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl (3S)-3-amino-3-(4-cyanophenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171245582 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | methyl (3S)-3-amino-3-(4-cyanophenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H16N2O2/c1-13(2,12(16)17-3)11(15)10-6-4-9(8-14)5-7-10/h4-7,11H,15H2,1-3H3/t11-/m0/s1 |
| InChIKey | QAJBOPHLOKRUGF-NSHDSACASA-N |
| XLogP | 1.76 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |