C10H15NO3 — CID 171250455
methyl (3S)-3-amino-3-(furan-3-yl)-2,2-dimethylpropanoate (PubChem CID 171250455) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(furan-3-yl)-2,2-dimethylpropanoate.
| Compound Name | methyl (3S)-3-amino-3-(furan-3-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 171250455 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | methyl (3S)-3-amino-3-(furan-3-yl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@@H](N)c1ccoc1 |
| InChI | InChI=1S/C10H15NO3/c1-10(2,9(12)13-3)8(11)7-4-5-14-6-7/h4-6,8H,11H2,1-3H3/t8-/m0/s1 |
| InChIKey | ZQFSKVHGTDYXJQ-QMMMGPOBSA-N |
| XLogP | 1.48 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |