C10H11F3O3 — CID 141388332
1-phenyl-2-(trifluoromethoxy)propane-1,1-diol (PubChem CID 141388332) has the molecular formula C10H11F3O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-phenyl-2-(trifluoromethoxy)propane-1,1-diol.
| Compound Name | 1-phenyl-2-(trifluoromethoxy)propane-1,1-diol |
|---|---|
| PubChem CID | 141388332 |
| Molecular Formula | C10H11F3O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-phenyl-2-(trifluoromethoxy)propane-1,1-diol |
| SMILES | CC(OC(F)(F)F)C(O)(O)c1ccccc1 |
| InChI | InChI=1S/C10H11F3O3/c1-7(16-10(11,12)13)9(14,15)8-5-3-2-4-6-8/h2-7,14-15H,1H3 |
| InChIKey | LTJUGJZZBVGFMO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|