C14H12F9NO2 — CID 132934571
(2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxy-2-methyl-3-phenylheptanamide (PubChem CID 132934571) has the molecular formula C14H12F9NO2 and a molecular weight of 397.24 g/mol. Its IUPAC name is (2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxy-2-methyl-3-phenylheptanamide.
| Compound Name | (2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxy-2-methyl-3-phenylheptanamide |
|---|---|
| PubChem CID | 132934571 |
| Molecular Formula | C14H12F9NO2 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (2S,3S)-4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxy-2-methyl-3-phenylheptanamide |
| SMILES | C[C@H](C(N)=O)[C@](O)(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F9NO2/c1-7(9(24)25)10(26,8-5-3-2-4-6-8)11(15,16)12(17,18)13(19,20)14(21,22)23/h2-7,26H,1H3,(H2,24,25)/t7-,10+/m1/s1 |
| InChIKey | FFODEYVPRRHFFG-XCBNKYQSSA-N |
| XLogP | 3.46 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|