C11H10F5NO3 — CID 2303256
(2S,3S)-2-azaniumyl-4,4,5,5,5-pentafluoro-3-hydroxy-3-phenylpentanoate (PubChem CID 2303256) has the molecular formula C11H10F5NO3 and a molecular weight of 299.19 g/mol. Its IUPAC name is (2S,3S)-2-azaniumyl-4,4,5,5,5-pentafluoro-3-hydroxy-3-phenylpentanoate.
| Compound Name | (2S,3S)-2-azaniumyl-4,4,5,5,5-pentafluoro-3-hydroxy-3-phenylpentanoate |
|---|---|
| PubChem CID | 2303256 |
| Molecular Formula | C11H10F5NO3 |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2S,3S)-2-azaniumyl-4,4,5,5,5-pentafluoro-3-hydroxy-3-phenylpentanoate |
| SMILES | [NH3+][C@H](C(=O)[O-])[C@@](O)(c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F5NO3/c12-10(13,11(14,15)16)9(20,7(17)8(18)19)6-4-2-1-3-5-6/h1-5,7,20H,17H2,(H,18,19)/t7-,9+/m1/s1 |
| InChIKey | RVHCEJPQUXMKLX-APPZFPTMSA-N |
| XLogP | -0.57 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|