C9H8F3NO2 — CID 7128415
(2R)-2-azaniumyl-2-[4-(trifluoromethyl)phenyl]acetate (PubChem CID 7128415) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is (2R)-2-azaniumyl-2-[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | (2R)-2-azaniumyl-2-[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 7128415 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | (2R)-2-azaniumyl-2-[4-(trifluoromethyl)phenyl]acetate |
| SMILES | [NH3+][C@@H](C(=O)[O-])c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3NO2/c10-9(11,12)6-3-1-5(2-4-6)7(13)8(14)15/h1-4,7H,13H2,(H,14,15)/t7-/m1/s1 |
| InChIKey | FANMQHUKZBBELZ-SSDOTTSWSA-N |
| XLogP | -0.26 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |