C12H15F3N2O4 — CID 161347199
(2S,3R)-3-amino-2-hydroxy-3-phenylbutanamide;2,2,2-trifluoroacetic acid (PubChem CID 161347199) has the molecular formula C12H15F3N2O4 and a molecular weight of 308.26 g/mol. Its IUPAC name is (2S,3R)-3-amino-2-hydroxy-3-phenylbutanamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3R)-3-amino-2-hydroxy-3-phenylbutanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161347199 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2S,3R)-3-amino-2-hydroxy-3-phenylbutanamide;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@](N)(c1ccccc1)[C@H](O)C(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O2.C2HF3O2/c1-10(12,8(13)9(11)14)7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6,8,13H,12H2,1H3,(H2,11,14);(H,6,7)/t8-,10-;/m1./s1 |
| InChIKey | KVSQGOWVUAESOQ-GHXDPTCOSA-N |
| XLogP | 0.34 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |