C10H13F3O3 — CID 175547904
methanol;toluene;2,2,2-trifluoroacetic acid (PubChem CID 175547904) has the molecular formula C10H13F3O3 and a molecular weight of 238.20 g/mol. Its IUPAC name is methanol;toluene;2,2,2-trifluoroacetic acid.
| Compound Name | methanol;toluene;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175547904 |
| Molecular Formula | C10H13F3O3 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methanol;toluene;2,2,2-trifluoroacetic acid |
| SMILES | CO.Cc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H8.C2HF3O2.CH4O/c1-7-5-3-2-4-6-7;3-2(4,5)1(6)7;1-2/h2-6H,1H3;(H,6,7);2H,1H3 |
| InChIKey | RZWJZQZLACCBNC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |