C12H18O4 — CID 175119768
3-methoxy-2-methyl-2-phenylbutane-1,1,1-triol (PubChem CID 175119768) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-methoxy-2-methyl-2-phenylbutane-1,1,1-triol.
| Compound Name | 3-methoxy-2-methyl-2-phenylbutane-1,1,1-triol |
|---|---|
| PubChem CID | 175119768 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-methoxy-2-methyl-2-phenylbutane-1,1,1-triol |
| SMILES | COC(C)C(C)(c1ccccc1)C(O)(O)O |
| InChI | InChI=1S/C12H18O4/c1-9(16-3)11(2,12(13,14)15)10-7-5-4-6-8-10/h4-9,13-15H,1-3H3 |
| InChIKey | NDBXVHAGBHRFPQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|