C18H22O4 — CID 175111370
4-methoxy-1,2-diphenylpentane-1,1,2-triol (PubChem CID 175111370) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-methoxy-1,2-diphenylpentane-1,1,2-triol.
| Compound Name | 4-methoxy-1,2-diphenylpentane-1,1,2-triol |
|---|---|
| PubChem CID | 175111370 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 4-methoxy-1,2-diphenylpentane-1,1,2-triol |
| SMILES | COC(C)CC(O)(c1ccccc1)C(O)(O)c1ccccc1 |
| InChI | InChI=1S/C18H22O4/c1-14(22-2)13-17(19,15-9-5-3-6-10-15)18(20,21)16-11-7-4-8-12-16/h3-12,14,19-21H,13H2,1-2H3 |
| InChIKey | IJLIQJDJEHBANW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|