C22H28N2O4 — CID 154665941
2-[methyl-[(2S)-2-methyl-4-oxo-3,3-diphenylhexyl]amino]ethyl nitrate (PubChem CID 154665941) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[methyl-[(2S)-2-methyl-4-oxo-3,3-diphenylhexyl]amino]ethyl nitrate.
| Compound Name | 2-[methyl-[(2S)-2-methyl-4-oxo-3,3-diphenylhexyl]amino]ethyl nitrate |
|---|---|
| PubChem CID | 154665941 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-[methyl-[(2S)-2-methyl-4-oxo-3,3-diphenylhexyl]amino]ethyl nitrate |
| SMILES | CCC(=O)C(c1ccccc1)(c1ccccc1)[C@H](C)CN(C)CCO[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N2O4/c1-4-21(25)22(19-11-7-5-8-12-19,20-13-9-6-10-14-20)18(2)17-23(3)15-16-28-24(26)27/h5-14,18H,4,15-17H2,1-3H3/t18-/m1/s1 |
| InChIKey | NJBYGZPYSUZLDD-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|