C21H27NO2 — CID 610077
N,N-dimethyl-5-oxo-4,4-diphenylheptan-2-amine oxide (PubChem CID 610077) has the molecular formula C21H27NO2 and a molecular weight of 325.40 g/mol. Its IUPAC name is N,N-dimethyl-5-oxo-4,4-diphenylheptan-2-amine oxide.
| Compound Name | N,N-dimethyl-5-oxo-4,4-diphenylheptan-2-amine oxide |
|---|---|
| PubChem CID | 610077 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | N,N-dimethyl-5-oxo-4,4-diphenylheptan-2-amine oxide |
| SMILES | CCC(=O)C(CC(C)[N+](C)(C)[O-])(C1=CC=CC=C1)C2=CC=CC=C2 |
| InChI | InChI=1S/C21H27NO2/c1-5-20(23)21(16-17(2)22(3,4)24,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3 |
| InChIKey | JAGZVXZVPUWAKA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 35.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | 388 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|