C22H30NO2+ — CID 164732578
[(2S,3R)-2-hydroxy-6-oxo-5,5-diphenyloctan-3-yl]-dimethylazanium (PubChem CID 164732578) has the molecular formula C22H30NO2+ and a molecular weight of 340.49 g/mol. Its IUPAC name is [(2S,3R)-2-hydroxy-6-oxo-5,5-diphenyloctan-3-yl]-dimethylazanium.
| Compound Name | [(2S,3R)-2-hydroxy-6-oxo-5,5-diphenyloctan-3-yl]-dimethylazanium |
|---|---|
| PubChem CID | 164732578 |
| Molecular Formula | C22H30NO2+ |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | [(2S,3R)-2-hydroxy-6-oxo-5,5-diphenyloctan-3-yl]-dimethylazanium |
| SMILES | CCC(=O)C(C[C@H]([C@H](C)O)[NH+](C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29NO2/c1-5-21(25)22(18-12-8-6-9-13-18,19-14-10-7-11-15-19)16-20(17(2)24)23(3)4/h6-15,17,20,24H,5,16H2,1-4H3/p+1/t17-,20+/m0/s1 |
| InChIKey | KYKRJLOBHCBIFL-FXAWDEMLSA-O |
| XLogP | 2.24 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |