C20H24N2O3 — CID 67430934
[(3S)-4-(dimethylamino)-3-methyl-4-oxo-1,2-diphenylbutan-2-yl] carbamate (PubChem CID 67430934) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(3S)-4-(dimethylamino)-3-methyl-4-oxo-1,2-diphenylbutan-2-yl] carbamate.
| Compound Name | [(3S)-4-(dimethylamino)-3-methyl-4-oxo-1,2-diphenylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 67430934 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [(3S)-4-(dimethylamino)-3-methyl-4-oxo-1,2-diphenylbutan-2-yl] carbamate |
| SMILES | C[C@H](C(=O)N(C)C)C(Cc1ccccc1)(OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O3/c1-15(18(23)22(2)3)20(25-19(21)24,17-12-8-5-9-13-17)14-16-10-6-4-7-11-16/h4-13,15H,14H2,1-3H3,(H2,21,24)/t15-,20?/m1/s1 |
| InChIKey | MNGPMYSMBDBAAF-IWPPFLRJSA-N |
| XLogP | 2.94 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |