C16H26N2O2 — CID 67818589
[(2S)-2-(3-methylbutylamino)-1-phenylbutan-2-yl] carbamate (PubChem CID 67818589) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is [(2S)-2-(3-methylbutylamino)-1-phenylbutan-2-yl] carbamate.
| Compound Name | [(2S)-2-(3-methylbutylamino)-1-phenylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 67818589 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | [(2S)-2-(3-methylbutylamino)-1-phenylbutan-2-yl] carbamate |
| SMILES | CC[C@](Cc1ccccc1)(NCCC(C)C)OC(N)=O |
| InChI | InChI=1S/C16H26N2O2/c1-4-16(20-15(17)19,18-11-10-13(2)3)12-14-8-6-5-7-9-14/h5-9,13,18H,4,10-12H2,1-3H3,(H2,17,19)/t16-/m0/s1 |
| InChIKey | JDYKIQZORXZDEM-INIZCTEOSA-N |
| XLogP | 3.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|