C22H28FNO2 — CID 77439760
[4-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2-phenylbutan-2-yl] propanoate (PubChem CID 77439760) has the molecular formula C22H28FNO2 and a molecular weight of 357.47 g/mol. Its IUPAC name is [4-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2-phenylbutan-2-yl] propanoate.
| Compound Name | [4-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2-phenylbutan-2-yl] propanoate |
|---|---|
| PubChem CID | 77439760 |
| Molecular Formula | C22H28FNO2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | [4-(dimethylamino)-1-(4-fluorophenyl)-3-methyl-2-phenylbutan-2-yl] propanoate |
| SMILES | CCC(=O)OC(Cc1ccc(F)cc1)(c1ccccc1)C(C)CN(C)C |
| InChI | InChI=1S/C22H28FNO2/c1-5-21(25)26-22(17(2)16-24(3)4,19-9-7-6-8-10-19)15-18-11-13-20(23)14-12-18/h6-14,17H,5,15-16H2,1-4H3 |
| InChIKey | FPEDXMKTXIFXFI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |