C28H30F4NO2+ — CID 164732589
dimethyl-[(2S)-2-methyl-3-(4-phenylphenyl)-3-propanoyloxy-4-(2,3,5,6-tetrafluorophenyl)butyl]azanium (PubChem CID 164732589) has the molecular formula C28H30F4NO2+ and a molecular weight of 488.55 g/mol. Its IUPAC name is dimethyl-[(2S)-2-methyl-3-(4-phenylphenyl)-3-propanoyloxy-4-(2,3,5,6-tetrafluorophenyl)butyl]azanium.
| Compound Name | dimethyl-[(2S)-2-methyl-3-(4-phenylphenyl)-3-propanoyloxy-4-(2,3,5,6-tetrafluorophenyl)butyl]azanium |
|---|---|
| PubChem CID | 164732589 |
| Molecular Formula | C28H30F4NO2+ |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | dimethyl-[(2S)-2-methyl-3-(4-phenylphenyl)-3-propanoyloxy-4-(2,3,5,6-tetrafluorophenyl)butyl]azanium |
| SMILES | CCC(=O)OC(Cc1c(F)c(F)cc(F)c1F)(c1ccc(-c2ccccc2)cc1)[C@@H](C)C[NH+](C)C |
| InChI | InChI=1S/C28H29F4NO2/c1-5-25(34)35-28(18(2)17-33(3)4,16-22-26(31)23(29)15-24(30)27(22)32)21-13-11-20(12-14-21)19-9-7-6-8-10-19/h6-15,18H,5,16-17H2,1-4H3/p+1/t18-,28?/m0/s1 |
| InChIKey | OBHFPWYUGJLNNL-BVFFRPSBSA-O |
| XLogP | 5.08 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|