C27H27F4NO — CID 154665968
(4R,6S)-6-(dimethylamino)-4-(4-phenylphenyl)-4-(2,3,5,6-tetrafluorophenyl)heptan-3-one (PubChem CID 154665968) has the molecular formula C27H27F4NO and a molecular weight of 457.51 g/mol. Its IUPAC name is (4R,6S)-6-(dimethylamino)-4-(4-phenylphenyl)-4-(2,3,5,6-tetrafluorophenyl)heptan-3-one.
| Compound Name | (4R,6S)-6-(dimethylamino)-4-(4-phenylphenyl)-4-(2,3,5,6-tetrafluorophenyl)heptan-3-one |
|---|---|
| PubChem CID | 154665968 |
| Molecular Formula | C27H27F4NO |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (4R,6S)-6-(dimethylamino)-4-(4-phenylphenyl)-4-(2,3,5,6-tetrafluorophenyl)heptan-3-one |
| SMILES | CCC(=O)[C@](C[C@H](C)N(C)C)(c1ccc(-c2ccccc2)cc1)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C27H27F4NO/c1-5-23(33)27(16-17(2)32(3)4,24-25(30)21(28)15-22(29)26(24)31)20-13-11-19(12-14-20)18-9-7-6-8-10-18/h6-15,17H,5,16H2,1-4H3/t17-,27-/m0/s1 |
| InChIKey | VNURCPVWZYMZAH-SOKVYYICSA-N |
| XLogP | 6.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|