About 6-(dimethylamino)-4,4-diphenylheptan-3-one
6-(dimethylamino)-4,4-diphenylheptan-3-one (PubChem CID 4095) has the molecular formula C21H27NO
and a molecular weight of 309.45 g/mol. Its IUPAC name is 6-(dimethylamino)-4,4-diphenylheptan-3-one.
Molecular Properties
| Compound Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one |
| PubChem CID | 4095 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 6-(dimethylamino)-4,4-diphenylheptan-3-one |
| SMILES | CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3 |
| InChIKey | USSIQXCVUWKGNF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(dimethylamino)-4,4-diphenylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-4,4-diphenylheptan-3-one?
The IUPAC name of 6-(dimethylamino)-4,4-diphenylheptan-3-one (CID 4095) is 6-(dimethylamino)-4,4-diphenylheptan-3-one.
What is the SMILES notation for 6-(dimethylamino)-4,4-diphenylheptan-3-one?
The canonical SMILES for 6-(dimethylamino)-4,4-diphenylheptan-3-one is CCC(=O)C(CC(C)N(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of 6-(dimethylamino)-4,4-diphenylheptan-3-one?
The InChIKey is USSIQXCVUWKGNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO/c1-5-20(23)21(16-17(2)22(3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-15,17H,5,16H2,1-4H3.
What are the key properties of 6-(dimethylamino)-4,4-diphenylheptan-3-one?
6-(dimethylamino)-4,4-diphenylheptan-3-one has a molecular weight of 309.45 g/mol, XLogP of 4.29, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-4,4-diphenylheptan-3-one is sourced from PubChem (CID 4095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).