About (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium
(4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium (PubChem CID 3775) has the molecular formula C23H33N2O+
and a molecular weight of 353.53 g/mol. Its IUPAC name is (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium.
Molecular Properties
| Compound Name | (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium |
| PubChem CID | 3775 |
| Molecular Formula | C23H33N2O+ |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium |
| SMILES | CC(C)[N+](C)(CCC(C(N)=O)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H32N2O/c1-18(2)25(5,19(3)4)17-16-23(22(24)26,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3,(H-,24,26)/p+1 |
| InChIKey | JTPUMZTWMWIVPA-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium?
The IUPAC name of (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium (CID 3775) is (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium.
What is the SMILES notation for (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium?
The canonical SMILES for (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium is CC(C)[N+](C)(CCC(C(N)=O)(c1ccccc1)c1ccccc1)C(C)C.
What is the InChIKey of (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium?
The InChIKey is JTPUMZTWMWIVPA-UHFFFAOYSA-O. The full InChI is InChI=1S/C23H32N2O/c1-18(2)25(5,19(3)4)17-16-23(22(24)26,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,18-19H,16-17H2,1-5H3,(H-,24,26)/p+1.
What are the key properties of (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium?
(4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium has a molecular weight of 353.53 g/mol, XLogP of 4.11, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-4-oxo-3,3-diphenylbutyl)-methyl-di(propan-2-yl)azanium is sourced from PubChem (CID 3775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).