About (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride
(3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride (PubChem CID 44723488) has the molecular formula C19H26ClNO
and a molecular weight of 319.88 g/mol. Its IUPAC name is (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride.
Molecular Properties
| Compound Name | (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride |
| PubChem CID | 44723488 |
| Molecular Formula | C19H26ClNO |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride |
| SMILES | CC(C[NH+](C)C)C(O)(Cc1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C19H25NO.ClH/c1-16(15-20(2)3)19(21,18-12-8-5-9-13-18)14-17-10-6-4-7-11-17;/h4-13,16,21H,14-15H2,1-3H3;1H |
| InChIKey | WRHOJMZRFAKSSV-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride?
The IUPAC name of (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride (CID 44723488) is (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride.
What is the SMILES notation for (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride?
The canonical SMILES for (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride is CC(C[NH+](C)C)C(O)(Cc1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride?
The InChIKey is WRHOJMZRFAKSSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25NO.ClH/c1-16(15-20(2)3)19(21,18-12-8-5-9-13-18)14-17-10-6-4-7-11-17;/h4-13,16,21H,14-15H2,1-3H3;1H.
What are the key properties of (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride?
(3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride has a molecular weight of 319.88 g/mol, XLogP of -1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride is sourced from PubChem (CID 44723488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).