C19H26ClNO — CID 44723488
(3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride (PubChem CID 44723488) has the molecular formula C19H26ClNO and a molecular weight of 319.88 g/mol. Its IUPAC name is (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride.
| Compound Name | (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 44723488 |
| Molecular Formula | C19H26ClNO |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (3-hydroxy-2-methyl-3,4-diphenylbutyl)-dimethylazanium chloride |
| SMILES | CC(C[NH+](C)C)C(O)(Cc1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C19H25NO.ClH/c1-16(15-20(2)3)19(21,18-12-8-5-9-13-18)14-17-10-6-4-7-11-17;/h4-13,16,21H,14-15H2,1-3H3;1H |
| InChIKey | WRHOJMZRFAKSSV-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |