C19H18ClNO — CID 139176344
(1R)-1,2-diphenyl-1-pyridin-1-ium-4-ylethanol chloride (PubChem CID 139176344) has the molecular formula C19H18ClNO and a molecular weight of 311.81 g/mol. Its IUPAC name is (1R)-1,2-diphenyl-1-pyridin-1-ium-4-ylethanol chloride.
| Compound Name | (1R)-1,2-diphenyl-1-pyridin-1-ium-4-ylethanol chloride |
|---|---|
| PubChem CID | 139176344 |
| Molecular Formula | C19H18ClNO |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (1R)-1,2-diphenyl-1-pyridin-1-ium-4-ylethanol chloride |
| SMILES | O[C@](Cc1ccccc1)(c1ccccc1)c1cc[nH+]cc1.[Cl-] |
| InChI | InChI=1S/C19H17NO.ClH/c21-19(17-9-5-2-6-10-17,18-11-13-20-14-12-18)15-16-7-3-1-4-8-16;/h1-14,21H,15H2;1H/t19-;/m1./s1 |
| InChIKey | SZUSPESHBHKQNJ-FSRHSHDFSA-N |
| XLogP | -0.02 |
| TPSA | 34.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |