C21H22ClN — CID 21496963
1,2,3-triphenylpropan-2-ylazanium chloride (PubChem CID 21496963) has the molecular formula C21H22ClN and a molecular weight of 323.87 g/mol. Its IUPAC name is 1,2,3-triphenylpropan-2-ylazanium chloride.
| Compound Name | 1,2,3-triphenylpropan-2-ylazanium chloride |
|---|---|
| PubChem CID | 21496963 |
| Molecular Formula | C21H22ClN |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1,2,3-triphenylpropan-2-ylazanium chloride |
| SMILES | [Cl-].[NH3+]C(Cc1ccccc1)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21N.ClH/c22-21(20-14-8-3-9-15-20,16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19;/h1-15H,16-17,22H2;1H |
| InChIKey | PHZMMDGTDRBROH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |