C16H20ClN — CID 110174053
(2-methyl-1,3-diphenylpropan-2-yl)azanium chloride (PubChem CID 110174053) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is (2-methyl-1,3-diphenylpropan-2-yl)azanium chloride.
| Compound Name | (2-methyl-1,3-diphenylpropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 110174053 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (2-methyl-1,3-diphenylpropan-2-yl)azanium chloride |
| SMILES | CC([NH3+])(Cc1ccccc1)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C16H19N.ClH/c1-16(17,12-14-8-4-2-5-9-14)13-15-10-6-3-7-11-15;/h2-11H,12-13,17H2,1H3;1H |
| InChIKey | BGXJDEAUEFTNIY-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |